(2,6-dimethyl-4-nitrophenyl)boronic acid

C8H10BNO4 — CID 130120841

IUPAC(2,6-dimethyl-4-nitrophenyl)boronic acid
SMILESCc1cc([N+](=O)[O-])cc(C)c1B(O)O
InChIInChI=1S/C8H10BNO4/c1-5-3-7(10(13)14)4-6(2)8(5)9(11)12/h3-4,11-12H,1-2H3
InChIKeyXQMBUXNZIMQJOD-UHFFFAOYSA-N
MW194.98 g/mol
LogP-0.11
Rot. Bonds2

About (2,6-dimethyl-4-nitrophenyl)boronic acid

(2,6-dimethyl-4-nitrophenyl)boronic acid (PubChem CID 130120841) has the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. Its IUPAC name is (2,6-dimethyl-4-nitrophenyl)boronic acid.

Molecular Properties

Compound Name(2,6-dimethyl-4-nitrophenyl)boronic acid
PubChem CID130120841
Molecular FormulaC8H10BNO4
Molecular Weight194.98 g/mol
Exact Mass195.07
IUPAC Name(2,6-dimethyl-4-nitrophenyl)boronic acid
SMILESCc1cc([N+](=O)[O-])cc(C)c1B(O)O
InChIInChI=1S/C8H10BNO4/c1-5-3-7(10(13)14)4-6(2)8(5)9(11)12/h3-4,11-12H,1-2H3
InChIKeyXQMBUXNZIMQJOD-UHFFFAOYSA-N
XLogP-0.11
TPSA83.60 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.98
LogP ≤ 5-0.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2,6-dimethyl-4-nitrophenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,6-dimethyl-4-nitrophenyl)boronic acid?
The IUPAC name of (2,6-dimethyl-4-nitrophenyl)boronic acid (CID 130120841) is (2,6-dimethyl-4-nitrophenyl)boronic acid.
What is the SMILES notation for (2,6-dimethyl-4-nitrophenyl)boronic acid?
The canonical SMILES for (2,6-dimethyl-4-nitrophenyl)boronic acid is Cc1cc([N+](=O)[O-])cc(C)c1B(O)O.
What is the InChIKey of (2,6-dimethyl-4-nitrophenyl)boronic acid?
The InChIKey is XQMBUXNZIMQJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BNO4/c1-5-3-7(10(13)14)4-6(2)8(5)9(11)12/h3-4,11-12H,1-2H3.
What are the key properties of (2,6-dimethyl-4-nitrophenyl)boronic acid?
(2,6-dimethyl-4-nitrophenyl)boronic acid has a molecular weight of 194.98 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethyl-4-nitrophenyl)boronic acid is sourced from PubChem (CID 130120841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).