C8H8NO3- — CID 6993803
2,6-dimethyl-4-nitrophenolate (PubChem CID 6993803) has the molecular formula C8H8NO3- and a molecular weight of 166.16 g/mol. Its IUPAC name is 2,6-dimethyl-4-nitrophenolate.
| Compound Name | 2,6-dimethyl-4-nitrophenolate |
|---|---|
| PubChem CID | 6993803 |
| Molecular Formula | C8H8NO3- |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 2,6-dimethyl-4-nitrophenolate |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1[O-] |
| InChI | InChI=1S/C8H9NO3/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,10H,1-2H3/p-1 |
| InChIKey | FNORUNUDZNWQFF-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|