C22H18N4O4 — CID 134924795
1,4,7,10-tetramethyl-2,8-dinitro-5,11-dihydroindolo[3,2-b]carbazole (PubChem CID 134924795) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 1,4,7,10-tetramethyl-2,8-dinitro-5,11-dihydroindolo[3,2-b]carbazole.
| Compound Name | 1,4,7,10-tetramethyl-2,8-dinitro-5,11-dihydroindolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 134924795 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1,4,7,10-tetramethyl-2,8-dinitro-5,11-dihydroindolo[3,2-b]carbazole |
| SMILES | Cc1cc([N+](=O)[O-])c(C)c2c1[nH]c1cc3c(cc12)[nH]c1c(C)cc([N+](=O)[O-])c(C)c13 |
| InChI | InChI=1S/C22H18N4O4/c1-9-5-17(25(27)28)11(3)19-13-7-16-14(8-15(13)23-21(9)19)20-12(4)18(26(29)30)6-10(2)22(20)24-16/h5-8,23-24H,1-4H3 |
| InChIKey | QLEHZDVXJYUATP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|