C16H16N4O2 — CID 6078917
(Z)-1-(5,8-dimethyl-6-nitro-9H-carbazol-3-yl)ethylidenehydrazine (PubChem CID 6078917) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is (Z)-1-(5,8-dimethyl-6-nitro-9H-carbazol-3-yl)ethylidenehydrazine.
| Compound Name | (Z)-1-(5,8-dimethyl-6-nitro-9H-carbazol-3-yl)ethylidenehydrazine |
|---|---|
| PubChem CID | 6078917 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (Z)-1-(5,8-dimethyl-6-nitro-9H-carbazol-3-yl)ethylidenehydrazine |
| SMILES | C/C(=N/N)c1ccc2[nH]c3c(C)cc([N+](=O)[O-])c(C)c3c2c1 |
| InChI | InChI=1S/C16H16N4O2/c1-8-6-14(20(21)22)9(2)15-12-7-11(10(3)19-17)4-5-13(12)18-16(8)15/h4-7,18H,17H2,1-3H3/b19-10- |
| InChIKey | KRBRNDLWTOCOTD-GRSHGNNSSA-N |
| XLogP | 3.53 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|