C30H26Br2N4O4 — CID 160511075
6-bromo-1,4-dimethyl-3-nitro-9H-carbazole;6-bromo-9-ethyl-1,4-dimethyl-3-nitrocarbazole (PubChem CID 160511075) has the molecular formula C30H26Br2N4O4 and a molecular weight of 666.37 g/mol. Its IUPAC name is 6-bromo-1,4-dimethyl-3-nitro-9H-carbazole;6-bromo-9-ethyl-1,4-dimethyl-3-nitrocarbazole.
| Compound Name | 6-bromo-1,4-dimethyl-3-nitro-9H-carbazole;6-bromo-9-ethyl-1,4-dimethyl-3-nitrocarbazole |
|---|---|
| PubChem CID | 160511075 |
| Molecular Formula | C30H26Br2N4O4 |
| Molecular Weight | 666.37 g/mol |
| Exact Mass | 664.03 |
| IUPAC Name | 6-bromo-1,4-dimethyl-3-nitro-9H-carbazole;6-bromo-9-ethyl-1,4-dimethyl-3-nitrocarbazole |
| SMILES | CCn1c2ccc(Br)cc2c2c(C)c([N+](=O)[O-])cc(C)c21.Cc1cc([N+](=O)[O-])c(C)c2c1[nH]c1ccc(Br)cc12 |
| InChI | InChI=1S/C16H15BrN2O2.C14H11BrN2O2/c1-4-18-13-6-5-11(17)8-12(13)15-10(3)14(19(20)21)7-9(2)16(15)18;1-7-5-12(17(18)19)8(2)13-10-6-9(15)3-4-11(10)16-14(7)13/h5-8H,4H2,1-3H3;3-6,16H,1-2H3 |
| InChIKey | QTAYTXFXABEQPG-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.37 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|