C8H3IN2O4 — CID 119089932
7-iodo-5-nitro-1H-indole-2,3-dione (PubChem CID 119089932) has the molecular formula C8H3IN2O4 and a molecular weight of 318.03 g/mol. Its IUPAC name is 7-iodo-5-nitro-1H-indole-2,3-dione.
| Compound Name | 7-iodo-5-nitro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 119089932 |
| Molecular Formula | C8H3IN2O4 |
| Molecular Weight | 318.03 g/mol |
| Exact Mass | 317.91 |
| IUPAC Name | 7-iodo-5-nitro-1H-indole-2,3-dione |
| SMILES | O=C1Nc2c(I)cc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C8H3IN2O4/c9-5-2-3(11(14)15)1-4-6(5)10-8(13)7(4)12/h1-2H,(H,10,12,13) |
| InChIKey | SNWWAKPPNSDKHR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.03 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|