C18H18I2N6O8 — CID 139194345
1,4-diazabicyclo[2.2.2]octane;bis(1-iodo-3,5-dinitrobenzene) (PubChem CID 139194345) has the molecular formula C18H18I2N6O8 and a molecular weight of 700.18 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;bis(1-iodo-3,5-dinitrobenzene).
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;bis(1-iodo-3,5-dinitrobenzene) |
|---|---|
| PubChem CID | 139194345 |
| Molecular Formula | C18H18I2N6O8 |
| Molecular Weight | 700.18 g/mol |
| Exact Mass | 699.93 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;bis(1-iodo-3,5-dinitrobenzene) |
| SMILES | C1CN2CCN1CC2.O=[N+]([O-])c1cc(I)cc([N+](=O)[O-])c1.O=[N+]([O-])c1cc(I)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/2C6H3IN2O4.C6H12N2/c2*7-4-1-5(8(10)11)3-6(2-4)9(12)13;1-2-8-5-3-7(1)4-6-8/h2*1-3H;1-6H2 |
| InChIKey | RFLAUXGPSVDCSB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|