About 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde
2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde (PubChem CID 138115501) has the molecular formula C10H6N2O5
and a molecular weight of 234.17 g/mol. Its IUPAC name is 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde |
| PubChem CID | 138115501 |
| Molecular Formula | C10H6N2O5 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde |
| SMILES | O=CCc1cc([N+](=O)[O-])cc2c1C(=O)NC2=O |
| InChI | InChI=1S/C10H6N2O5/c13-2-1-5-3-6(12(16)17)4-7-8(5)10(15)11-9(7)14/h2-4H,1H2,(H,11,14,15) |
| InChIKey | PQTXOWVFGDENOV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde?
The IUPAC name of 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde (CID 138115501) is 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde.
What is the SMILES notation for 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde?
The canonical SMILES for 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde is O=CCc1cc([N+](=O)[O-])cc2c1C(=O)NC2=O.
What is the InChIKey of 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde?
The InChIKey is PQTXOWVFGDENOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O5/c13-2-1-5-3-6(12(16)17)4-7-8(5)10(15)11-9(7)14/h2-4H,1H2,(H,11,14,15).
What are the key properties of 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde?
2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde has a molecular weight of 234.17 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-nitro-1,3-dioxoisoindol-4-yl)acetaldehyde is sourced from PubChem (CID 138115501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).