C14H17N3O6 — CID 139812205
5-[[bis(2-hydroxyethyl)amino]methyl]-7-nitro-1,4-dihydroquinoline-2,3-dione (PubChem CID 139812205) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is 5-[[bis(2-hydroxyethyl)amino]methyl]-7-nitro-1,4-dihydroquinoline-2,3-dione.
| Compound Name | 5-[[bis(2-hydroxyethyl)amino]methyl]-7-nitro-1,4-dihydroquinoline-2,3-dione |
|---|---|
| PubChem CID | 139812205 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 5-[[bis(2-hydroxyethyl)amino]methyl]-7-nitro-1,4-dihydroquinoline-2,3-dione |
| SMILES | O=C1Cc2c(CN(CCO)CCO)cc([N+](=O)[O-])cc2NC1=O |
| InChI | InChI=1S/C14H17N3O6/c18-3-1-16(2-4-19)8-9-5-10(17(22)23)6-12-11(9)7-13(20)14(21)15-12/h5-6,18-19H,1-4,7-8H2,(H,15,21) |
| InChIKey | CJIRPWZGNRESOA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|