C17H17N4O5+ — CID 143599707
(15E,17E)-14-hydroxy-14,18-dimethyl-15-nitro-4,13-diaza-14-azoniatetracyclo[10.6.0.02,6.07,11]octadeca-1(12),2(6),7(11),15,17-pentaene-3,5-dione (PubChem CID 143599707) has the molecular formula C17H17N4O5+ and a molecular weight of 357.35 g/mol. Its IUPAC name is (15E,17E)-14-hydroxy-14,18-dimethyl-15-nitro-4,13-diaza-14-azoniatetracyclo[10.6.0.02,6.07,11]octadeca-1(12),2(6),7(11),15,17-pentaene-3,5-dione.
| Compound Name | (15E,17E)-14-hydroxy-14,18-dimethyl-15-nitro-4,13-diaza-14-azoniatetracyclo[10.6.0.02,6.07,11]octadeca-1(12),2(6),7(11),15,17-pentaene-3,5-dione |
|---|---|
| PubChem CID | 143599707 |
| Molecular Formula | C17H17N4O5+ |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (15E,17E)-14-hydroxy-14,18-dimethyl-15-nitro-4,13-diaza-14-azoniatetracyclo[10.6.0.02,6.07,11]octadeca-1(12),2(6),7(11),15,17-pentaene-3,5-dione |
| SMILES | C/C1=C/C=C(/[N+](=O)[O-])[N+](C)(O)Nc2c3c(c4c(c21)C(=O)NC4=O)CCC3 |
| InChI | InChI=1S/C17H16N4O5/c1-8-6-7-11(20(24)25)21(2,26)19-15-10-5-3-4-9(10)13-14(12(8)15)17(23)18-16(13)22/h6-7,26H,3-5H2,1-2H3,(H-,18,19,22,23)/p+1/b8-6-,11-7- |
| InChIKey | FDFCEDIVSUOLMK-NFNKYSHCSA-O |
| XLogP | 1.76 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|