C10H9N3O4 — CID 59761847
5-amino-4,7-dimethyl-6-nitroisoindole-1,3-dione (PubChem CID 59761847) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 5-amino-4,7-dimethyl-6-nitroisoindole-1,3-dione.
| Compound Name | 5-amino-4,7-dimethyl-6-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 59761847 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 5-amino-4,7-dimethyl-6-nitroisoindole-1,3-dione |
| SMILES | Cc1c(N)c([N+](=O)[O-])c(C)c2c1C(=O)NC2=O |
| InChI | InChI=1S/C10H9N3O4/c1-3-5-6(10(15)12-9(5)14)4(2)8(7(3)11)13(16)17/h11H2,1-2H3,(H,12,14,15) |
| InChIKey | GRVVXHAWEUFMSX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|