C18H24N2O4 — CID 160582326
3-methoxy-2,6-dimethylaniline;1-methoxy-2,4-dimethyl-3-nitrobenzene (PubChem CID 160582326) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-methoxy-2,6-dimethylaniline;1-methoxy-2,4-dimethyl-3-nitrobenzene.
| Compound Name | 3-methoxy-2,6-dimethylaniline;1-methoxy-2,4-dimethyl-3-nitrobenzene |
|---|---|
| PubChem CID | 160582326 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-methoxy-2,6-dimethylaniline;1-methoxy-2,4-dimethyl-3-nitrobenzene |
| SMILES | COc1ccc(C)c(N)c1C.COc1ccc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C9H11NO3.C9H13NO/c1-6-4-5-8(13-3)7(2)9(6)10(11)12;1-6-4-5-8(11-3)7(2)9(6)10/h4-5H,1-3H3;4-5H,10H2,1-3H3 |
| InChIKey | RBYCZXXPZQSGGO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|