C9H13N2O2+ — CID 89323692
(3-amino-2,4-dimethylphenyl)-methoxy-oxoazanium (PubChem CID 89323692) has the molecular formula C9H13N2O2+ and a molecular weight of 181.21 g/mol. Its IUPAC name is (3-amino-2,4-dimethylphenyl)-methoxy-oxoazanium.
| Compound Name | (3-amino-2,4-dimethylphenyl)-methoxy-oxoazanium |
|---|---|
| PubChem CID | 89323692 |
| Molecular Formula | C9H13N2O2+ |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | (3-amino-2,4-dimethylphenyl)-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(C)c(N)c1C |
| InChI | InChI=1S/C9H13N2O2/c1-6-4-5-8(11(12)13-3)7(2)9(6)10/h4-5H,10H2,1-3H3/q+1 |
| InChIKey | YXDVAPDOUWFXMD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|