C11H18N2O — CID 130914275
6-[(1R)-1-amino-2-methoxyethyl]-2,3-dimethylaniline (PubChem CID 130914275) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 6-[(1R)-1-amino-2-methoxyethyl]-2,3-dimethylaniline.
| Compound Name | 6-[(1R)-1-amino-2-methoxyethyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 130914275 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 6-[(1R)-1-amino-2-methoxyethyl]-2,3-dimethylaniline |
| SMILES | COC[C@H](N)c1ccc(C)c(C)c1N |
| InChI | InChI=1S/C11H18N2O/c1-7-4-5-9(10(12)6-14-3)11(13)8(7)2/h4-5,10H,6,12-13H2,1-3H3/t10-/m0/s1 |
| InChIKey | JICMZLDXBXLSJO-JTQLQIEISA-N |
| XLogP | 1.53 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|