C11H18N2 — CID 116855521
1-(2,3,4-trimethylphenyl)ethane-1,2-diamine (PubChem CID 116855521) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-(2,3,4-trimethylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2,3,4-trimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116855521 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-(2,3,4-trimethylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccc(C(N)CN)c(C)c1C |
| InChI | InChI=1S/C11H18N2/c1-7-4-5-10(11(13)6-12)9(3)8(7)2/h4-5,11H,6,12-13H2,1-3H3 |
| InChIKey | CWSYBUUOXMYQSZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |