C11H17NS — CID 116830565
2-amino-2-(2,3,4-trimethylphenyl)ethanethiol (PubChem CID 116830565) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 2-amino-2-(2,3,4-trimethylphenyl)ethanethiol.
| Compound Name | 2-amino-2-(2,3,4-trimethylphenyl)ethanethiol |
|---|---|
| PubChem CID | 116830565 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2-amino-2-(2,3,4-trimethylphenyl)ethanethiol |
| SMILES | Cc1ccc(C(N)CS)c(C)c1C |
| InChI | InChI=1S/C11H17NS/c1-7-4-5-10(11(12)6-13)9(3)8(7)2/h4-5,11,13H,6,12H2,1-3H3 |
| InChIKey | NAAAPNRRHSRQMK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|