C11H16O — CID 130125335
1-(2,3,4-trimethylphenyl)ethanol (PubChem CID 130125335) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-(2,3,4-trimethylphenyl)ethanol.
| Compound Name | 1-(2,3,4-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 130125335 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 1-(2,3,4-trimethylphenyl)ethanol |
| SMILES | Cc1ccc(C(C)O)c(C)c1C |
| InChI | InChI=1S/C11H16O/c1-7-5-6-11(10(4)12)9(3)8(7)2/h5-6,10,12H,1-4H3 |
| InChIKey | GGQVDHWLZUNKSG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |