C32H42O — CID 67182206
2,3-bis[3-(2,3,4-trimethylphenyl)butan-2-yl]phenol (PubChem CID 67182206) has the molecular formula C32H42O and a molecular weight of 442.69 g/mol. Its IUPAC name is 2,3-bis[3-(2,3,4-trimethylphenyl)butan-2-yl]phenol.
| Compound Name | 2,3-bis[3-(2,3,4-trimethylphenyl)butan-2-yl]phenol |
|---|---|
| PubChem CID | 67182206 |
| Molecular Formula | C32H42O |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | 2,3-bis[3-(2,3,4-trimethylphenyl)butan-2-yl]phenol |
| SMILES | Cc1ccc(C(C)C(C)c2cccc(O)c2C(C)C(C)c2ccc(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C32H42O/c1-18-14-16-28(22(5)20(18)3)24(7)25(8)30-12-11-13-31(33)32(30)27(10)26(9)29-17-15-19(2)21(4)23(29)6/h11-17,24-27,33H,1-10H3 |
| InChIKey | PRFMMUMRKPNESG-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |