C20H28O — CID 67178643
benzene;2,3-di(butan-2-yl)phenol (PubChem CID 67178643) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is benzene;2,3-di(butan-2-yl)phenol.
| Compound Name | benzene;2,3-di(butan-2-yl)phenol |
|---|---|
| PubChem CID | 67178643 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | benzene;2,3-di(butan-2-yl)phenol |
| SMILES | CCC(C)c1cccc(O)c1C(C)CC.c1ccccc1 |
| InChI | InChI=1S/C14H22O.C6H6/c1-5-10(3)12-8-7-9-13(15)14(12)11(4)6-2;1-2-4-6-5-3-1/h7-11,15H,5-6H2,1-4H3;1-6H |
| InChIKey | BAIYIOAOIVVBFS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |