C9H12O3 — CID 11229010
3-[(1R)-1-hydroxypropyl]benzene-1,2-diol (PubChem CID 11229010) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-[(1R)-1-hydroxypropyl]benzene-1,2-diol.
| Compound Name | 3-[(1R)-1-hydroxypropyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 11229010 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-[(1R)-1-hydroxypropyl]benzene-1,2-diol |
| SMILES | CC[C@@H](O)c1cccc(O)c1O |
| InChI | InChI=1S/C9H12O3/c1-2-7(10)6-4-3-5-8(11)9(6)12/h3-5,7,10-12H,2H2,1H3/t7-/m1/s1 |
| InChIKey | VCTFYMKANZNZGJ-SSDOTTSWSA-N |
| XLogP | 1.54 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|