C11H16O3 — CID 174450984
3-(2-hydroxypentan-3-yl)benzene-1,2-diol (PubChem CID 174450984) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-(2-hydroxypentan-3-yl)benzene-1,2-diol.
| Compound Name | 3-(2-hydroxypentan-3-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 174450984 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 3-(2-hydroxypentan-3-yl)benzene-1,2-diol |
| SMILES | CCC(c1cccc(O)c1O)C(C)O |
| InChI | InChI=1S/C11H16O3/c1-3-8(7(2)12)9-5-4-6-10(13)11(9)14/h4-8,12-14H,3H2,1-2H3 |
| InChIKey | CPGZVGNGQIQMEE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|