C11H16O4 — CID 18798728
3-(1,4-dihydroxypentyl)benzene-1,2-diol (PubChem CID 18798728) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-(1,4-dihydroxypentyl)benzene-1,2-diol.
| Compound Name | 3-(1,4-dihydroxypentyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 18798728 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-(1,4-dihydroxypentyl)benzene-1,2-diol |
| SMILES | CC(O)CCC(O)c1cccc(O)c1O |
| InChI | InChI=1S/C11H16O4/c1-7(12)5-6-9(13)8-3-2-4-10(14)11(8)15/h2-4,7,9,12-15H,5-6H2,1H3 |
| InChIKey | HVQIYQUAOGWWPT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|