C9H9NO2 — CID 131537955
2-(2,3-dihydroxyphenyl)propanenitrile (PubChem CID 131537955) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)propanenitrile.
| Compound Name | 2-(2,3-dihydroxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 131537955 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)propanenitrile |
| SMILES | CC(C#N)c1cccc(O)c1O |
| InChI | InChI=1S/C9H9NO2/c1-6(5-10)7-3-2-4-8(11)9(7)12/h2-4,6,11-12H,1H3 |
| InChIKey | NGPIKQJXPVPDJF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|