C12H16O3 — CID 174741450
3-(4-hydroxyhex-5-en-3-yl)benzene-1,2-diol (PubChem CID 174741450) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-(4-hydroxyhex-5-en-3-yl)benzene-1,2-diol.
| Compound Name | 3-(4-hydroxyhex-5-en-3-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 174741450 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-(4-hydroxyhex-5-en-3-yl)benzene-1,2-diol |
| SMILES | C=CC(O)C(CC)c1cccc(O)c1O |
| InChI | InChI=1S/C12H16O3/c1-3-8(10(13)4-2)9-6-5-7-11(14)12(9)15/h4-8,10,13-15H,2-3H2,1H3 |
| InChIKey | JRJDSIYLJYMURZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|