About 2,3,6-tri(butan-2-yl)phenol
2,3,6-tri(butan-2-yl)phenol (PubChem CID 101292764) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,3,6-tri(butan-2-yl)phenol.
Molecular Properties
| Compound Name | 2,3,6-tri(butan-2-yl)phenol |
| PubChem CID | 101292764 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2,3,6-tri(butan-2-yl)phenol |
| SMILES | CCC(C)c1ccc(C(C)CC)c(C(C)CC)c1O |
| InChI | InChI=1S/C18H30O/c1-7-12(4)15-10-11-16(13(5)8-2)18(19)17(15)14(6)9-3/h10-14,19H,7-9H2,1-6H3 |
| InChIKey | UKMFGMNFTBYUKV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,6-tri(butan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-tri(butan-2-yl)phenol?
The IUPAC name of 2,3,6-tri(butan-2-yl)phenol (CID 101292764) is 2,3,6-tri(butan-2-yl)phenol.
What is the SMILES notation for 2,3,6-tri(butan-2-yl)phenol?
The canonical SMILES for 2,3,6-tri(butan-2-yl)phenol is CCC(C)c1ccc(C(C)CC)c(C(C)CC)c1O.
What is the InChIKey of 2,3,6-tri(butan-2-yl)phenol?
The InChIKey is UKMFGMNFTBYUKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-7-12(4)15-10-11-16(13(5)8-2)18(19)17(15)14(6)9-3/h10-14,19H,7-9H2,1-6H3.
What are the key properties of 2,3,6-tri(butan-2-yl)phenol?
2,3,6-tri(butan-2-yl)phenol has a molecular weight of 262.44 g/mol, XLogP of 5.93, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-tri(butan-2-yl)phenol is sourced from PubChem (CID 101292764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).