C39H48O — CID 67252041
2,3,4-tris[3-(2-methylphenyl)butan-2-yl]phenol (PubChem CID 67252041) has the molecular formula C39H48O and a molecular weight of 532.81 g/mol. Its IUPAC name is 2,3,4-tris[3-(2-methylphenyl)butan-2-yl]phenol.
| Compound Name | 2,3,4-tris[3-(2-methylphenyl)butan-2-yl]phenol |
|---|---|
| PubChem CID | 67252041 |
| Molecular Formula | C39H48O |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | 2,3,4-tris[3-(2-methylphenyl)butan-2-yl]phenol |
| SMILES | Cc1ccccc1C(C)C(C)c1ccc(O)c(C(C)C(C)c2ccccc2C)c1C(C)C(C)c1ccccc1C |
| InChI | InChI=1S/C39H48O/c1-24-16-10-13-19-33(24)27(4)28(5)36-22-23-37(40)39(32(9)30(7)35-21-15-12-18-26(35)3)38(36)31(8)29(6)34-20-14-11-17-25(34)2/h10-23,27-32,40H,1-9H3 |
| InChIKey | LQMVQWQBVBEHRX-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |