C13H20N2O — CID 116847102
N'-methyl-2-(2,3,4-trimethylphenyl)propanehydrazide (PubChem CID 116847102) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N'-methyl-2-(2,3,4-trimethylphenyl)propanehydrazide.
| Compound Name | N'-methyl-2-(2,3,4-trimethylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116847102 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N'-methyl-2-(2,3,4-trimethylphenyl)propanehydrazide |
| SMILES | CNNC(=O)C(C)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C13H20N2O/c1-8-6-7-12(10(3)9(8)2)11(4)13(16)15-14-5/h6-7,11,14H,1-5H3,(H,15,16) |
| InChIKey | YHTFIQDDTQPIJI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|