C14H22N2O2 — CID 116961134
2,3-bis(methylamino)-3-(2,3,4-trimethylphenyl)propanoic acid (PubChem CID 116961134) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,3-bis(methylamino)-3-(2,3,4-trimethylphenyl)propanoic acid.
| Compound Name | 2,3-bis(methylamino)-3-(2,3,4-trimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 116961134 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2,3-bis(methylamino)-3-(2,3,4-trimethylphenyl)propanoic acid |
| SMILES | CNC(C(=O)O)C(NC)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C14H22N2O2/c1-8-6-7-11(10(3)9(8)2)12(15-4)13(16-5)14(17)18/h6-7,12-13,15-16H,1-5H3,(H,17,18) |
| InChIKey | NJPGBBFMQVTOLX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |