C10H10F3N2O3+ — CID 153077525
[3-[(2,2-difluoroacetyl)amino]-2-fluoro-4-methylphenyl]-methoxy-oxoazanium (PubChem CID 153077525) has the molecular formula C10H10F3N2O3+ and a molecular weight of 263.19 g/mol. Its IUPAC name is [3-[(2,2-difluoroacetyl)amino]-2-fluoro-4-methylphenyl]-methoxy-oxoazanium.
| Compound Name | [3-[(2,2-difluoroacetyl)amino]-2-fluoro-4-methylphenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 153077525 |
| Molecular Formula | C10H10F3N2O3+ |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | [3-[(2,2-difluoroacetyl)amino]-2-fluoro-4-methylphenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(C)c(NC(=O)C(F)F)c1F |
| InChI | InChI=1S/C10H9F3N2O3/c1-5-3-4-6(15(17)18-2)7(11)8(5)14-10(16)9(12)13/h3-4,9H,1-2H3/p+1 |
| InChIKey | VMPKJRBFPFRMEF-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|