C17H14F2N2O5 — CID 8887168
[(2S)-1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-methyl-3-nitrobenzoate (PubChem CID 8887168) has the molecular formula C17H14F2N2O5 and a molecular weight of 364.30 g/mol. Its IUPAC name is [(2S)-1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-methyl-3-nitrobenzoate.
| Compound Name | [(2S)-1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 8887168 |
| Molecular Formula | C17H14F2N2O5 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [(2S)-1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)C(=O)Nc2c(F)cccc2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14F2N2O5/c1-9-6-7-11(8-14(9)21(24)25)17(23)26-10(2)16(22)20-15-12(18)4-3-5-13(15)19/h3-8,10H,1-2H3,(H,20,22)/t10-/m0/s1 |
| InChIKey | KQMUUOSVVGMNDO-JTQLQIEISA-N |
| XLogP | 3.37 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|