C18H17F2N3O5 — CID 46623284
[1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-(dimethylamino)-3-nitrobenzoate (PubChem CID 46623284) has the molecular formula C18H17F2N3O5 and a molecular weight of 393.35 g/mol. Its IUPAC name is [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-(dimethylamino)-3-nitrobenzoate.
| Compound Name | [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-(dimethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 46623284 |
| Molecular Formula | C18H17F2N3O5 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] 4-(dimethylamino)-3-nitrobenzoate |
| SMILES | CC(OC(=O)c1ccc(N(C)C)c([N+](=O)[O-])c1)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C18H17F2N3O5/c1-10(17(24)21-16-12(19)5-4-6-13(16)20)28-18(25)11-7-8-14(22(2)3)15(9-11)23(26)27/h4-10H,1-3H3,(H,21,24) |
| InChIKey | WSIYNPNJEPUHPH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|