C22H27N3O5 — CID 9484024
[(2S)-1-oxo-1-[[(1R)-1-phenylbutyl]amino]propan-2-yl] 4-(dimethylamino)-3-nitrobenzoate (PubChem CID 9484024) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[[(1R)-1-phenylbutyl]amino]propan-2-yl] 4-(dimethylamino)-3-nitrobenzoate.
| Compound Name | [(2S)-1-oxo-1-[[(1R)-1-phenylbutyl]amino]propan-2-yl] 4-(dimethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 9484024 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [(2S)-1-oxo-1-[[(1R)-1-phenylbutyl]amino]propan-2-yl] 4-(dimethylamino)-3-nitrobenzoate |
| SMILES | CCC[C@@H](NC(=O)[C@H](C)OC(=O)c1ccc(N(C)C)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O5/c1-5-9-18(16-10-7-6-8-11-16)23-21(26)15(2)30-22(27)17-12-13-19(24(3)4)20(14-17)25(28)29/h6-8,10-15,18H,5,9H2,1-4H3,(H,23,26)/t15-,18+/m0/s1 |
| InChIKey | FZUHZVGMWCIAKF-MAUKXSAKSA-N |
| XLogP | 3.86 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|