C11H14F2N2O — CID 82818428
N-(2,6-difluoro-3-methylphenyl)-2-(methylamino)propanamide (PubChem CID 82818428) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is N-(2,6-difluoro-3-methylphenyl)-2-(methylamino)propanamide.
| Compound Name | N-(2,6-difluoro-3-methylphenyl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 82818428 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-(2,6-difluoro-3-methylphenyl)-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)Nc1c(F)ccc(C)c1F |
| InChI | InChI=1S/C11H14F2N2O/c1-6-4-5-8(12)10(9(6)13)15-11(16)7(2)14-3/h4-5,7,14H,1-3H3,(H,15,16) |
| InChIKey | FZKOXSMLBBGVDG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |