C12H15F2NO2 — CID 82818644
3-(2,6-difluoro-3-methylanilino)-2-methylbutanoic acid (PubChem CID 82818644) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 3-(2,6-difluoro-3-methylanilino)-2-methylbutanoic acid.
| Compound Name | 3-(2,6-difluoro-3-methylanilino)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 82818644 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-(2,6-difluoro-3-methylanilino)-2-methylbutanoic acid |
| SMILES | Cc1ccc(F)c(NC(C)C(C)C(=O)O)c1F |
| InChI | InChI=1S/C12H15F2NO2/c1-6-4-5-9(13)11(10(6)14)15-8(3)7(2)12(16)17/h4-5,7-8,15H,1-3H3,(H,16,17) |
| InChIKey | CTCZDKGIWNZYIX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |