C11H11F2NO3 — CID 82815283
2-[(2,6-difluoro-3-methylbenzoyl)amino]propanoic acid (PubChem CID 82815283) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is 2-[(2,6-difluoro-3-methylbenzoyl)amino]propanoic acid.
| Compound Name | 2-[(2,6-difluoro-3-methylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82815283 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[(2,6-difluoro-3-methylbenzoyl)amino]propanoic acid |
| SMILES | Cc1ccc(F)c(C(=O)NC(C)C(=O)O)c1F |
| InChI | InChI=1S/C11H11F2NO3/c1-5-3-4-7(12)8(9(5)13)10(15)14-6(2)11(16)17/h3-4,6H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | YMSZZUDAOXKSRD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |