C14H18BrF2NO — CID 82817962
N-(1-bromo-4-methylpentan-2-yl)-2,6-difluoro-3-methylbenzamide (PubChem CID 82817962) has the molecular formula C14H18BrF2NO and a molecular weight of 334.20 g/mol. Its IUPAC name is N-(1-bromo-4-methylpentan-2-yl)-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-(1-bromo-4-methylpentan-2-yl)-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 82817962 |
| Molecular Formula | C14H18BrF2NO |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(1-bromo-4-methylpentan-2-yl)-2,6-difluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NC(CBr)CC(C)C)c1F |
| InChI | InChI=1S/C14H18BrF2NO/c1-8(2)6-10(7-15)18-14(19)12-11(16)5-4-9(3)13(12)17/h4-5,8,10H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | NQIOFLHTADEVIM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|