C15H19F2NO3 — CID 82799828
methyl 2-[(2,6-difluoro-3-methylbenzoyl)amino]-4-methylpentanoate (PubChem CID 82799828) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is methyl 2-[(2,6-difluoro-3-methylbenzoyl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(2,6-difluoro-3-methylbenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 82799828 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 2-[(2,6-difluoro-3-methylbenzoyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C15H19F2NO3/c1-8(2)7-11(15(20)21-4)18-14(19)12-10(16)6-5-9(3)13(12)17/h5-6,8,11H,7H2,1-4H3,(H,18,19) |
| InChIKey | HMZSPXJMRRVFAK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |