C10H15NO — CID 13265347
3-(methoxymethyl)-2,6-dimethylaniline (PubChem CID 13265347) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,6-dimethylaniline.
| Compound Name | 3-(methoxymethyl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 13265347 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3-(methoxymethyl)-2,6-dimethylaniline |
| SMILES | COCc1ccc(C)c(N)c1C |
| InChI | InChI=1S/C10H15NO/c1-7-4-5-9(6-12-3)8(2)10(7)11/h4-5H,6,11H2,1-3H3 |
| InChIKey | BQCBAWIDBXWVMI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|