About 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine
2-(methoxymethyl)-3,5-dimethylpyridin-4-amine (PubChem CID 103182974) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine |
| PubChem CID | 103182974 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine |
| SMILES | COCc1ncc(C)c(N)c1C |
| InChI | InChI=1S/C9H14N2O/c1-6-4-11-8(5-12-3)7(2)9(6)10/h4H,5H2,1-3H3,(H2,10,11) |
| InChIKey | VXVABGKBLKTULS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine?
The IUPAC name of 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine (CID 103182974) is 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine.
What is the SMILES notation for 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine?
The canonical SMILES for 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine is COCc1ncc(C)c(N)c1C.
What is the InChIKey of 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine?
The InChIKey is VXVABGKBLKTULS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-6-4-11-8(5-12-3)7(2)9(6)10/h4H,5H2,1-3H3,(H2,10,11).
What are the key properties of 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine?
2-(methoxymethyl)-3,5-dimethylpyridin-4-amine has a molecular weight of 166.22 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-3,5-dimethylpyridin-4-amine is sourced from PubChem (CID 103182974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).