C10H17N3O — CID 103182114
2-[[methoxy(methyl)amino]methyl]-3,5-dimethylpyridin-4-amine (PubChem CID 103182114) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-[[methoxy(methyl)amino]methyl]-3,5-dimethylpyridin-4-amine.
| Compound Name | 2-[[methoxy(methyl)amino]methyl]-3,5-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 103182114 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-[[methoxy(methyl)amino]methyl]-3,5-dimethylpyridin-4-amine |
| SMILES | CON(C)Cc1ncc(C)c(N)c1C |
| InChI | InChI=1S/C10H17N3O/c1-7-5-12-9(6-13(3)14-4)8(2)10(7)11/h5H,6H2,1-4H3,(H2,11,12) |
| InChIKey | AIXZARJBDKKRDO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|