C16H21N3O — CID 103182279
2-[(4-methoxy-N-methylanilino)methyl]-3,5-dimethylpyridin-4-amine (PubChem CID 103182279) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[(4-methoxy-N-methylanilino)methyl]-3,5-dimethylpyridin-4-amine.
| Compound Name | 2-[(4-methoxy-N-methylanilino)methyl]-3,5-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 103182279 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-[(4-methoxy-N-methylanilino)methyl]-3,5-dimethylpyridin-4-amine |
| SMILES | COc1ccc(N(C)Cc2ncc(C)c(N)c2C)cc1 |
| InChI | InChI=1S/C16H21N3O/c1-11-9-18-15(12(2)16(11)17)10-19(3)13-5-7-14(20-4)8-6-13/h5-9H,10H2,1-4H3,(H2,17,18) |
| InChIKey | KCOVKDIIPNONBP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|