C12H20N2O — CID 103183038
3,5-dimethyl-2-(2-methylpropoxymethyl)pyridin-4-amine (PubChem CID 103183038) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 3,5-dimethyl-2-(2-methylpropoxymethyl)pyridin-4-amine.
| Compound Name | 3,5-dimethyl-2-(2-methylpropoxymethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 103183038 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3,5-dimethyl-2-(2-methylpropoxymethyl)pyridin-4-amine |
| SMILES | Cc1cnc(COCC(C)C)c(C)c1N |
| InChI | InChI=1S/C12H20N2O/c1-8(2)6-15-7-11-10(4)12(13)9(3)5-14-11/h5,8H,6-7H2,1-4H3,(H2,13,14) |
| InChIKey | YRFXSFBNCCYCNA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |