C14H15FN2O — CID 103183013
2-[(4-fluorophenoxy)methyl]-3,5-dimethylpyridin-4-amine (PubChem CID 103183013) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-3,5-dimethylpyridin-4-amine.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-3,5-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 103183013 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-3,5-dimethylpyridin-4-amine |
| SMILES | Cc1cnc(COc2ccc(F)cc2)c(C)c1N |
| InChI | InChI=1S/C14H15FN2O/c1-9-7-17-13(10(2)14(9)16)8-18-12-5-3-11(15)4-6-12/h3-7H,8H2,1-2H3,(H2,16,17) |
| InChIKey | IRZMNGZIVNCONK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |