C17H26N4 — CID 161457493
3,6-dimethylbenzene-1,2-diamine;2,4,6-trimethylbenzene-1,3-diamine (PubChem CID 161457493) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3,6-dimethylbenzene-1,2-diamine;2,4,6-trimethylbenzene-1,3-diamine.
| Compound Name | 3,6-dimethylbenzene-1,2-diamine;2,4,6-trimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 161457493 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 3,6-dimethylbenzene-1,2-diamine;2,4,6-trimethylbenzene-1,3-diamine |
| SMILES | Cc1cc(C)c(N)c(C)c1N.Cc1ccc(C)c(N)c1N |
| InChI | InChI=1S/C9H14N2.C8H12N2/c1-5-4-6(2)9(11)7(3)8(5)10;1-5-3-4-6(2)8(10)7(5)9/h4H,10-11H2,1-3H3;3-4H,9-10H2,1-2H3 |
| InChIKey | WBIUELNROOETRB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|