About 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline
3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline (PubChem CID 139266297) has the molecular formula C16H20N2Te2
and a molecular weight of 495.55 g/mol. Its IUPAC name is 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline |
| PubChem CID | 139266297 |
| Molecular Formula | C16H20N2Te2 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 499.98 |
| IUPAC Name | 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline |
| SMILES | Cc1cc([Te][Te]c2ccc(C)c(N)c2C)cc(C)c1N |
| InChI | InChI=1S/C16H20N2Te2/c1-9-5-6-14(12(4)16(9)18)20-19-13-7-10(2)15(17)11(3)8-13/h5-8H,17-18H2,1-4H3 |
| InChIKey | PJLUHGJKTPULAR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline?
The IUPAC name of 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline (CID 139266297) is 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline.
What is the SMILES notation for 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline?
The canonical SMILES for 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline is Cc1cc([Te][Te]c2ccc(C)c(N)c2C)cc(C)c1N.
What is the InChIKey of 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline?
The InChIKey is PJLUHGJKTPULAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2Te2/c1-9-5-6-14(12(4)16(9)18)20-19-13-7-10(2)15(17)11(3)8-13/h5-8H,17-18H2,1-4H3.
What are the key properties of 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline?
3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline has a molecular weight of 495.55 g/mol, XLogP of 1.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-amino-3,5-dimethylphenyl)ditellanyl]-2,6-dimethylaniline is sourced from PubChem (CID 139266297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).