C9H15N2+ — CID 145475903
(3-amino-2,4,6-trimethylphenyl)azanium (PubChem CID 145475903) has the molecular formula C9H15N2+ and a molecular weight of 151.23 g/mol. Its IUPAC name is (3-amino-2,4,6-trimethylphenyl)azanium.
| Compound Name | (3-amino-2,4,6-trimethylphenyl)azanium |
|---|---|
| PubChem CID | 145475903 |
| Molecular Formula | C9H15N2+ |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | (3-amino-2,4,6-trimethylphenyl)azanium |
| SMILES | Cc1cc(C)c([NH3+])c(C)c1N |
| InChI | InChI=1S/C9H14N2/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,10-11H2,1-3H3/p+1 |
| InChIKey | ZVDSMYGTJDFNHN-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|