C9H15N3 — CID 163890734
2-N,4,6-trimethylbenzene-1,2,3-triamine (PubChem CID 163890734) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-N,4,6-trimethylbenzene-1,2,3-triamine.
| Compound Name | 2-N,4,6-trimethylbenzene-1,2,3-triamine |
|---|---|
| PubChem CID | 163890734 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 2-N,4,6-trimethylbenzene-1,2,3-triamine |
| SMILES | CNc1c(N)c(C)cc(C)c1N |
| InChI | InChI=1S/C9H15N3/c1-5-4-6(2)8(11)9(12-3)7(5)10/h4,12H,10-11H2,1-3H3 |
| InChIKey | QBHKRUHHHNCFBS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|