C8H11N3O2 — CID 175921943
1-N,3-dimethyl-5-nitrobenzene-1,2-diamine (PubChem CID 175921943) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-N,3-dimethyl-5-nitrobenzene-1,2-diamine.
| Compound Name | 1-N,3-dimethyl-5-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 175921943 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-N,3-dimethyl-5-nitrobenzene-1,2-diamine |
| SMILES | CNc1cc([N+](=O)[O-])cc(C)c1N |
| InChI | InChI=1S/C8H11N3O2/c1-5-3-6(11(12)13)4-7(10-2)8(5)9/h3-4,10H,9H2,1-2H3 |
| InChIKey | IBNVJXVKTMSZOZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|