C8H11N3O4S — CID 70663598
2,6-dimethyl-4-nitrobenzenesulfonohydrazide (PubChem CID 70663598) has the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2,6-dimethyl-4-nitrobenzenesulfonohydrazide.
| Compound Name | 2,6-dimethyl-4-nitrobenzenesulfonohydrazide |
|---|---|
| PubChem CID | 70663598 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2,6-dimethyl-4-nitrobenzenesulfonohydrazide |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1S(=O)(=O)NN |
| InChI | InChI=1S/C8H11N3O4S/c1-5-3-7(11(12)13)4-6(2)8(5)16(14,15)10-9/h3-4,10H,9H2,1-2H3 |
| InChIKey | RESUEQBJCNMHOG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|