C8H10N2O4S — CID 37477651
N,2-dimethyl-4-nitrobenzenesulfonamide (PubChem CID 37477651) has the molecular formula C8H10N2O4S and a molecular weight of 230.25 g/mol. Its IUPAC name is N,2-dimethyl-4-nitrobenzenesulfonamide.
| Compound Name | N,2-dimethyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 37477651 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | N,2-dimethyl-4-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C8H10N2O4S/c1-6-5-7(10(11)12)3-4-8(6)15(13,14)9-2/h3-5,9H,1-2H3 |
| InChIKey | UQEWYFUVGJOBRZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|